C15H24N2O2 — CID 62066747
4-(1,3-benzodioxol-5-yl)-2-methyl-2-N-propylbutane-1,2-diamine (PubChem CID 62066747) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-methyl-2-N-propylbutane-1,2-diamine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-methyl-2-N-propylbutane-1,2-diamine |
|---|---|
| PubChem CID | 62066747 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-methyl-2-N-propylbutane-1,2-diamine |
| SMILES | CCCNC(C)(CN)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H24N2O2/c1-3-8-17-15(2,10-16)7-6-12-4-5-13-14(9-12)19-11-18-13/h4-5,9,17H,3,6-8,10-11,16H2,1-2H3 |
| InChIKey | ZRLWWTIYXPKUMS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |