About 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine
1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine (PubChem CID 62067147) has the molecular formula C8H11N7
and a molecular weight of 205.22 g/mol. Its IUPAC name is 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine |
| PubChem CID | 62067147 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine |
| SMILES | NC1CCN(c2cncc3nnnn23)C1 |
| InChI | InChI=1S/C8H11N7/c9-6-1-2-14(5-6)8-4-10-3-7-11-12-13-15(7)8/h3-4,6H,1-2,5,9H2 |
| InChIKey | QQOCGNPAERBGCD-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine?
The IUPAC name of 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine (CID 62067147) is 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine.
What is the SMILES notation for 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine?
The canonical SMILES for 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine is NC1CCN(c2cncc3nnnn23)C1.
What is the InChIKey of 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine?
The InChIKey is QQOCGNPAERBGCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N7/c9-6-1-2-14(5-6)8-4-10-3-7-11-12-13-15(7)8/h3-4,6H,1-2,5,9H2.
What are the key properties of 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine?
1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine has a molecular weight of 205.22 g/mol, XLogP of -0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(tetrazolo[1,5-a]pyrazin-5-yl)pyrrolidin-3-amine is sourced from PubChem (CID 62067147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).