C9H7BrN2S — CID 620683
4-(4-bromophenyl)-1,3-thiazol-2-amine (PubChem CID 620683) has the molecular formula C9H7BrN2S and a molecular weight of 255.14 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-bromophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 620683 |
| Molecular Formula | C9H7BrN2S |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | 4-(4-bromophenyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C9H7BrN2S/c10-7-3-1-6(2-4-7)8-5-13-9(11)12-8/h1-5H,(H2,11,12) |
| InChIKey | ZBRNKOLWXWMLTA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |