C14H21N3O2 — CID 62069126
2-[4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]phenoxy]acetamide (PubChem CID 62069126) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-[4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 62069126 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 2-[4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]phenoxy]acetamide |
| SMILES | NCC1CCN(Cc2ccc(OCC(N)=O)cc2)C1 |
| InChI | InChI=1S/C14H21N3O2/c15-7-12-5-6-17(9-12)8-11-1-3-13(4-2-11)19-10-14(16)18/h1-4,12H,5-10,15H2,(H2,16,18) |
| InChIKey | NYEXPIDANUXYKF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |