About [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine
[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine (PubChem CID 62069871) has the molecular formula C4H5F2N3O
and a molecular weight of 149.10 g/mol. Its IUPAC name is [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine.
Analyze [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine?
The IUPAC name of [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine (CID 62069871) is [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine.
What is the SMILES notation for [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine?
The canonical SMILES for [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine is NCc1nnc(C(F)F)o1.
What is the InChIKey of [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine?
The InChIKey is HMPXSWBHMJLRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F2N3O/c5-3(6)4-9-8-2(1-7)10-4/h3H,1,7H2.
What are the key properties of [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine?
[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine has a molecular weight of 149.10 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]methanamine is sourced from PubChem (CID 62069871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).