About 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine
2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine (PubChem CID 62070943) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine |
| PubChem CID | 62070943 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine |
| SMILES | CCC(C)c1nnc(CCN)o1 |
| InChI | InChI=1S/C8H15N3O/c1-3-6(2)8-11-10-7(12-8)4-5-9/h6H,3-5,9H2,1-2H3 |
| InChIKey | CTRACRMVHSZMGP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine?
The IUPAC name of 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine (CID 62070943) is 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine.
What is the SMILES notation for 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine?
The canonical SMILES for 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine is CCC(C)c1nnc(CCN)o1.
What is the InChIKey of 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine?
The InChIKey is CTRACRMVHSZMGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-3-6(2)8-11-10-7(12-8)4-5-9/h6H,3-5,9H2,1-2H3.
What are the key properties of 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine?
2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine has a molecular weight of 169.23 g/mol, XLogP of 1.08, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-butan-2-yl-1,3,4-oxadiazol-2-yl)ethanamine is sourced from PubChem (CID 62070943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).