C22H18N2O6S4 — CID 6207336
(5E)-3-(2,4-dimethoxyphenyl)-5-[3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6207336) has the molecular formula C22H18N2O6S4 and a molecular weight of 534.66 g/mol. Its IUPAC name is (5E)-3-(2,4-dimethoxyphenyl)-5-[3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2,4-dimethoxyphenyl)-5-[3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6207336 |
| Molecular Formula | C22H18N2O6S4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.00 |
| IUPAC Name | (5E)-3-(2,4-dimethoxyphenyl)-5-[3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)/C(=C3\SC(=S)N(c4ccc(OC)cc4OC)C3=O)SC2=S)c(OC)c1 |
| InChI | InChI=1S/C22H18N2O6S4/c1-27-11-5-7-13(15(9-11)29-3)23-19(25)17(33-21(23)31)18-20(26)24(22(32)34-18)14-8-6-12(28-2)10-16(14)30-4/h5-10H,1-4H3/b18-17+ |
| InChIKey | IEWASTVXMOSIMN-ISLYRVAYSA-N |
| XLogP | 4.36 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|