C14H12BrNO4 — CID 62073783
5-bromo-2-[(5-ethylfuran-2-carbonyl)amino]benzoic acid (PubChem CID 62073783) has the molecular formula C14H12BrNO4 and a molecular weight of 338.16 g/mol. Its IUPAC name is 5-bromo-2-[(5-ethylfuran-2-carbonyl)amino]benzoic acid.
| Compound Name | 5-bromo-2-[(5-ethylfuran-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 62073783 |
| Molecular Formula | C14H12BrNO4 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 5-bromo-2-[(5-ethylfuran-2-carbonyl)amino]benzoic acid |
| SMILES | CCc1ccc(C(=O)Nc2ccc(Br)cc2C(=O)O)o1 |
| InChI | InChI=1S/C14H12BrNO4/c1-2-9-4-6-12(20-9)13(17)16-11-5-3-8(15)7-10(11)14(18)19/h3-7H,2H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | DOYRBHARWSWMCO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |