C11H12ClN3O2 — CID 62075077
1-[5-chloro-2-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]ethanamine (PubChem CID 62075077) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 1-[5-chloro-2-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]ethanamine.
| Compound Name | 1-[5-chloro-2-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 62075077 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 1-[5-chloro-2-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]ethanamine |
| SMILES | CC(N)c1cc(Cl)ccc1OCc1ncon1 |
| InChI | InChI=1S/C11H12ClN3O2/c1-7(13)9-4-8(12)2-3-10(9)16-5-11-14-6-17-15-11/h2-4,6-7H,5,13H2,1H3 |
| InChIKey | FCIMPONVTWHFTB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |