About 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine
4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine (PubChem CID 62075189) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine |
| PubChem CID | 62075189 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine |
| SMILES | CCCCCc1nc(C(C)C)sc1N |
| InChI | InChI=1S/C11H20N2S/c1-4-5-6-7-9-10(12)14-11(13-9)8(2)3/h8H,4-7,12H2,1-3H3 |
| InChIKey | RRJITKPCTGSOSE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine?
The IUPAC name of 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine (CID 62075189) is 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine.
What is the SMILES notation for 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine?
The canonical SMILES for 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine is CCCCCc1nc(C(C)C)sc1N.
What is the InChIKey of 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine?
The InChIKey is RRJITKPCTGSOSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-4-5-6-7-9-10(12)14-11(13-9)8(2)3/h8H,4-7,12H2,1-3H3.
What are the key properties of 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine?
4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine has a molecular weight of 212.36 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentyl-2-propan-2-yl-1,3-thiazol-5-amine is sourced from PubChem (CID 62075189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).