C16H22N4O — CID 62076132
4-amino-N-methyl-N-(2-phenylethyl)-5-propyl-1H-pyrazole-3-carboxamide (PubChem CID 62076132) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-amino-N-methyl-N-(2-phenylethyl)-5-propyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-amino-N-methyl-N-(2-phenylethyl)-5-propyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 62076132 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4-amino-N-methyl-N-(2-phenylethyl)-5-propyl-1H-pyrazole-3-carboxamide |
| SMILES | CCCc1[nH]nc(C(=O)N(C)CCc2ccccc2)c1N |
| InChI | InChI=1S/C16H22N4O/c1-3-7-13-14(17)15(19-18-13)16(21)20(2)11-10-12-8-5-4-6-9-12/h4-6,8-9H,3,7,10-11,17H2,1-2H3,(H,18,19) |
| InChIKey | WEWYRBAKYKNISU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |