C11H16O2 — CID 62077800
cyclohexen-1-yl(oxolan-3-yl)methanone (PubChem CID 62077800) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is cyclohexen-1-yl(oxolan-3-yl)methanone.
| Compound Name | cyclohexen-1-yl(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 62077800 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | cyclohexen-1-yl(oxolan-3-yl)methanone |
| SMILES | O=C(C1=CCCCC1)C1CCOC1 |
| InChI | InChI=1S/C11H16O2/c12-11(10-6-7-13-8-10)9-4-2-1-3-5-9/h4,10H,1-3,5-8H2 |
| InChIKey | YBAMTTUJLFXYBS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |