About 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol
2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 620779) has the molecular formula C11H10F6O
and a molecular weight of 272.19 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol |
| PubChem CID | 620779 |
| Molecular Formula | C11H10F6O |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F6O/c1-9(2,18)6-3-7(10(12,13)14)5-8(4-6)11(15,16)17/h3-5,18H,1-2H3 |
| InChIKey | CLPUBDXEFYRXMU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol (CID 620779) is 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol is CC(C)(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol?
The InChIKey is CLPUBDXEFYRXMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F6O/c1-9(2,18)6-3-7(10(12,13)14)5-8(4-6)11(15,16)17/h3-5,18H,1-2H3.
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol?
2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol has a molecular weight of 272.19 g/mol, XLogP of 3.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]propan-2-ol is sourced from PubChem (CID 620779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).