C9H12F5N — CID 62078311
1-(cyclohexen-1-yl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 62078311) has the molecular formula C9H12F5N and a molecular weight of 229.19 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | 1-(cyclohexen-1-yl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 62078311 |
| Molecular Formula | C9H12F5N |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(cyclohexen-1-yl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | NC(C1=CCCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F5N/c10-8(11,9(12,13)14)7(15)6-4-2-1-3-5-6/h4,7H,1-3,5,15H2 |
| InChIKey | BIVFAMQIWWVBIG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|