About 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one
2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 62078591) has the molecular formula C17H19NOS
and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| PubChem CID | 62078591 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | CC(C)(C)c1ccc(-c2nc3c(s2)C(=O)CCC3)cc1 |
| InChI | InChI=1S/C17H19NOS/c1-17(2,3)12-9-7-11(8-10-12)16-18-13-5-4-6-14(19)15(13)20-16/h7-10H,4-6H2,1-3H3 |
| InChIKey | PKUCITAWACKHPA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The IUPAC name of 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (CID 62078591) is 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
What is the SMILES notation for 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The canonical SMILES for 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one is CC(C)(C)c1ccc(-c2nc3c(s2)C(=O)CCC3)cc1.
What is the InChIKey of 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The InChIKey is PKUCITAWACKHPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NOS/c1-17(2,3)12-9-7-11(8-10-12)16-18-13-5-4-6-14(19)15(13)20-16/h7-10H,4-6H2,1-3H3.
What are the key properties of 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one has a molecular weight of 285.41 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one is sourced from PubChem (CID 62078591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).