C17H22O — CID 62078829
1-(cyclopenten-1-yl)-3-methyl-2-phenylpentan-1-one (PubChem CID 62078829) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(cyclopenten-1-yl)-3-methyl-2-phenylpentan-1-one.
| Compound Name | 1-(cyclopenten-1-yl)-3-methyl-2-phenylpentan-1-one |
|---|---|
| PubChem CID | 62078829 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-(cyclopenten-1-yl)-3-methyl-2-phenylpentan-1-one |
| SMILES | CCC(C)C(C(=O)C1=CCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H22O/c1-3-13(2)16(14-9-5-4-6-10-14)17(18)15-11-7-8-12-15/h4-6,9-11,13,16H,3,7-8,12H2,1-2H3 |
| InChIKey | SBXWHUKBJOCRSJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |