C18H27NO2 — CID 62079043
N-[cyclohexen-1-yl-(3,4-dimethoxyphenyl)methyl]propan-1-amine (PubChem CID 62079043) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[cyclohexen-1-yl-(3,4-dimethoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[cyclohexen-1-yl-(3,4-dimethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 62079043 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-[cyclohexen-1-yl-(3,4-dimethoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCC1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H27NO2/c1-4-12-19-18(14-8-6-5-7-9-14)15-10-11-16(20-2)17(13-15)21-3/h8,10-11,13,18-19H,4-7,9,12H2,1-3H3 |
| InChIKey | FGOPSEPSGBLJCH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|