C27H50O3Si2 — CID 620791
1-(10,13-dimethyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-trimethylsilyloxyethanone (PubChem CID 620791) has the molecular formula C27H50O3Si2 and a molecular weight of 478.87 g/mol. Its IUPAC name is 1-(10,13-dimethyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-trimethylsilyloxyethanone.
| Compound Name | 1-(10,13-dimethyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-trimethylsilyloxyethanone |
|---|---|
| PubChem CID | 620791 |
| Molecular Formula | C27H50O3Si2 |
| Molecular Weight | 478.87 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | 1-(10,13-dimethyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-trimethylsilyloxyethanone |
| SMILES | CC12CCC(O[Si](C)(C)C)CC1CCC1C2CCC2(C)C(C(=O)CO[Si](C)(C)C)CCC12 |
| InChI | InChI=1S/C27H50O3Si2/c1-26-15-13-20(30-32(6,7)8)17-19(26)9-10-21-22-11-12-24(25(28)18-29-31(3,4)5)27(22,2)16-14-23(21)26/h19-24H,9-18H2,1-8H3 |
| InChIKey | LHAVSYHEPNCPLB-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.87 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|