About 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one
2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 62079136) has the molecular formula C11H8BrNOS2
and a molecular weight of 314.23 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
Molecular Properties
| Compound Name | 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| PubChem CID | 62079136 |
| Molecular Formula | C11H8BrNOS2 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 312.92 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | O=C1CCCc2nc(-c3ccc(Br)s3)sc21 |
| InChI | InChI=1S/C11H8BrNOS2/c12-9-5-4-8(15-9)11-13-6-2-1-3-7(14)10(6)16-11/h4-5H,1-3H2 |
| InChIKey | BGUOBFBTRGCPMW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The IUPAC name of 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (CID 62079136) is 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
What is the SMILES notation for 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The canonical SMILES for 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one is O=C1CCCc2nc(-c3ccc(Br)s3)sc21.
What is the InChIKey of 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The InChIKey is BGUOBFBTRGCPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNOS2/c12-9-5-4-8(15-9)11-13-6-2-1-3-7(14)10(6)16-11/h4-5H,1-3H2.
What are the key properties of 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one has a molecular weight of 314.23 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromothiophen-2-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one is sourced from PubChem (CID 62079136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).