About N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine
N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 62079691) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
Analyze N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine?
The IUPAC name of N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (CID 62079691) is N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
What is the SMILES notation for N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine?
The canonical SMILES for N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine is CNC1CCCc2ncsc21.
What is the InChIKey of N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine?
The InChIKey is QUJLGGKBPFPNRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c1-9-6-3-2-4-7-8(6)11-5-10-7/h5-6,9H,2-4H2,1H3.
What are the key properties of N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine?
N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine has a molecular weight of 168.26 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine is sourced from PubChem (CID 62079691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).