C14H15N3O2S — CID 62079703
N-methyl-2-(2-nitrophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 62079703) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-methyl-2-(2-nitrophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | N-methyl-2-(2-nitrophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 62079703 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-methyl-2-(2-nitrophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | CNC1CCCc2nc(-c3ccccc3[N+](=O)[O-])sc21 |
| InChI | InChI=1S/C14H15N3O2S/c1-15-10-6-4-7-11-13(10)20-14(16-11)9-5-2-3-8-12(9)17(18)19/h2-3,5,8,10,15H,4,6-7H2,1H3 |
| InChIKey | KZLBLGYEBQKTPF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|