C8H11ClN2O2 — CID 62080110
methyl 4-chloro-5-propyl-1H-pyrazole-3-carboxylate (PubChem CID 62080110) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is methyl 4-chloro-5-propyl-1H-pyrazole-3-carboxylate.
| Compound Name | methyl 4-chloro-5-propyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 62080110 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | methyl 4-chloro-5-propyl-1H-pyrazole-3-carboxylate |
| SMILES | CCCc1[nH]nc(C(=O)OC)c1Cl |
| InChI | InChI=1S/C8H11ClN2O2/c1-3-4-5-6(9)7(11-10-5)8(12)13-2/h3-4H2,1-2H3,(H,10,11) |
| InChIKey | OUUXIYJRGWNQOZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |