C11H18N4O3 — CID 62080806
methyl 2-[(4-amino-5-ethyl-1H-pyrazole-3-carbonyl)-ethylamino]acetate (PubChem CID 62080806) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 2-[(4-amino-5-ethyl-1H-pyrazole-3-carbonyl)-ethylamino]acetate.
| Compound Name | methyl 2-[(4-amino-5-ethyl-1H-pyrazole-3-carbonyl)-ethylamino]acetate |
|---|---|
| PubChem CID | 62080806 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | methyl 2-[(4-amino-5-ethyl-1H-pyrazole-3-carbonyl)-ethylamino]acetate |
| SMILES | CCc1[nH]nc(C(=O)N(CC)CC(=O)OC)c1N |
| InChI | InChI=1S/C11H18N4O3/c1-4-7-9(12)10(14-13-7)11(17)15(5-2)6-8(16)18-3/h4-6,12H2,1-3H3,(H,13,14) |
| InChIKey | ZQFIGWNFLRGPII-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |