C15H20N2O3S — CID 62081849
2-propyl-4-(2,4,5-trimethoxyphenyl)-1,3-thiazol-5-amine (PubChem CID 62081849) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-propyl-4-(2,4,5-trimethoxyphenyl)-1,3-thiazol-5-amine.
| Compound Name | 2-propyl-4-(2,4,5-trimethoxyphenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 62081849 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-propyl-4-(2,4,5-trimethoxyphenyl)-1,3-thiazol-5-amine |
| SMILES | CCCc1nc(-c2cc(OC)c(OC)cc2OC)c(N)s1 |
| InChI | InChI=1S/C15H20N2O3S/c1-5-6-13-17-14(15(16)21-13)9-7-11(19-3)12(20-4)8-10(9)18-2/h7-8H,5-6,16H2,1-4H3 |
| InChIKey | MGFDZUFUPGORAJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |