C15H12N2S — CID 62081863
4-(4-phenylphenyl)-1,3-thiazol-5-amine (PubChem CID 62081863) has the molecular formula C15H12N2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-1,3-thiazol-5-amine.
| Compound Name | 4-(4-phenylphenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 62081863 |
| Molecular Formula | C15H12N2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 4-(4-phenylphenyl)-1,3-thiazol-5-amine |
| SMILES | Nc1scnc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N2S/c16-15-14(17-10-18-15)13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-10H,16H2 |
| InChIKey | VLIBNPJORKJWQE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |