C15H14Br2N2O2 — CID 62083752
N-cyclopropyl-3-[(4,5-dibromofuran-2-yl)methylamino]benzamide (PubChem CID 62083752) has the molecular formula C15H14Br2N2O2 and a molecular weight of 414.10 g/mol. Its IUPAC name is N-cyclopropyl-3-[(4,5-dibromofuran-2-yl)methylamino]benzamide.
| Compound Name | N-cyclopropyl-3-[(4,5-dibromofuran-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 62083752 |
| Molecular Formula | C15H14Br2N2O2 |
| Molecular Weight | 414.10 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | N-cyclopropyl-3-[(4,5-dibromofuran-2-yl)methylamino]benzamide |
| SMILES | O=C(NC1CC1)c1cccc(NCc2cc(Br)c(Br)o2)c1 |
| InChI | InChI=1S/C15H14Br2N2O2/c16-13-7-12(21-14(13)17)8-18-11-3-1-2-9(6-11)15(20)19-10-4-5-10/h1-3,6-7,10,18H,4-5,8H2,(H,19,20) |
| InChIKey | JNKMHEVQROOXIL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.10 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |