C16H19N3O2 — CID 62083995
5-[benzyl(methyl)amino]-2-propan-2-ylpyrimidine-4-carboxylic acid (PubChem CID 62083995) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-[benzyl(methyl)amino]-2-propan-2-ylpyrimidine-4-carboxylic acid.
| Compound Name | 5-[benzyl(methyl)amino]-2-propan-2-ylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 62083995 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 5-[benzyl(methyl)amino]-2-propan-2-ylpyrimidine-4-carboxylic acid |
| SMILES | CC(C)c1ncc(N(C)Cc2ccccc2)c(C(=O)O)n1 |
| InChI | InChI=1S/C16H19N3O2/c1-11(2)15-17-9-13(14(18-15)16(20)21)19(3)10-12-7-5-4-6-8-12/h4-9,11H,10H2,1-3H3,(H,20,21) |
| InChIKey | SLAWUPFBOBEDNM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |