About 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide
1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide (PubChem CID 62084042) has the molecular formula C7H12N2O2S2
and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide.
Molecular Properties
| Compound Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide |
| PubChem CID | 62084042 |
| Molecular Formula | C7H12N2O2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide |
| SMILES | Cc1nc(C(C)S(N)(=O)=O)c(C)s1 |
| InChI | InChI=1S/C7H12N2O2S2/c1-4-7(9-6(3)12-4)5(2)13(8,10)11/h5H,1-3H3,(H2,8,10,11) |
| InChIKey | BHJITSNQCAMIGI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide?
The IUPAC name of 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide (CID 62084042) is 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide.
What is the SMILES notation for 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide?
The canonical SMILES for 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide is Cc1nc(C(C)S(N)(=O)=O)c(C)s1.
What is the InChIKey of 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide?
The InChIKey is BHJITSNQCAMIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S2/c1-4-7(9-6(3)12-4)5(2)13(8,10)11/h5H,1-3H3,(H2,8,10,11).
What are the key properties of 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide?
1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide has a molecular weight of 220.32 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethyl-1,3-thiazol-4-yl)ethanesulfonamide is sourced from PubChem (CID 62084042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).