About N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide
N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 62084754) has the molecular formula C7H12N2O4S2
and a molecular weight of 252.32 g/mol. Its IUPAC name is N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide |
| PubChem CID | 62084754 |
| Molecular Formula | C7H12N2O4S2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | N#CCNS(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H12N2O4S2/c8-3-4-9-15(12,13)7-1-5-14(10,11)6-2-7/h7,9H,1-2,4-6H2 |
| InChIKey | VAJLQGIWHJBFLH-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide?
The IUPAC name of N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide (CID 62084754) is N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide.
What is the SMILES notation for N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide?
The canonical SMILES for N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide is N#CCNS(=O)(=O)C1CCS(=O)(=O)CC1.
What is the InChIKey of N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide?
The InChIKey is VAJLQGIWHJBFLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O4S2/c8-3-4-9-15(12,13)7-1-5-14(10,11)6-2-7/h7,9H,1-2,4-6H2.
What are the key properties of N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide?
N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide has a molecular weight of 252.32 g/mol, XLogP of -0.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-1,1-dioxothiane-4-sulfonamide is sourced from PubChem (CID 62084754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).