About N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine
N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine (PubChem CID 62084882) has the molecular formula C13H20Br2N2O
and a molecular weight of 380.12 g/mol. Its IUPAC name is N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine |
| PubChem CID | 62084882 |
| Molecular Formula | C13H20Br2N2O |
| Molecular Weight | 380.12 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine |
| SMILES | CCN(C1CCCC1)C(CN)c1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C13H20Br2N2O/c1-2-17(9-5-3-4-6-9)11(8-16)12-7-10(14)13(15)18-12/h7,9,11H,2-6,8,16H2,1H3 |
| InChIKey | OQSRDFQMTGKLAI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.12 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine?
The IUPAC name of N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine (CID 62084882) is N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine.
What is the SMILES notation for N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine?
The canonical SMILES for N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine is CCN(C1CCCC1)C(CN)c1cc(Br)c(Br)o1.
What is the InChIKey of N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine?
The InChIKey is OQSRDFQMTGKLAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20Br2N2O/c1-2-17(9-5-3-4-6-9)11(8-16)12-7-10(14)13(15)18-12/h7,9,11H,2-6,8,16H2,1H3.
What are the key properties of N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine?
N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine has a molecular weight of 380.12 g/mol, XLogP of 4.07, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1-(4,5-dibromofuran-2-yl)-N-ethylethane-1,2-diamine is sourced from PubChem (CID 62084882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).