About 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid
5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid (PubChem CID 62084936) has the molecular formula C11H15NO6S3
and a molecular weight of 353.44 g/mol. Its IUPAC name is 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid |
| PubChem CID | 62084936 |
| Molecular Formula | C11H15NO6S3 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(NS(=O)(=O)C2CCS(=O)(=O)CC2)sc1C(=O)O |
| InChI | InChI=1S/C11H15NO6S3/c1-7-6-9(19-10(7)11(13)14)12-21(17,18)8-2-4-20(15,16)5-3-8/h6,8,12H,2-5H2,1H3,(H,13,14) |
| InChIKey | RTICGMIRUJDABY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid?
The IUPAC name of 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid (CID 62084936) is 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid.
What is the SMILES notation for 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid?
The canonical SMILES for 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid is Cc1cc(NS(=O)(=O)C2CCS(=O)(=O)CC2)sc1C(=O)O.
What is the InChIKey of 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid?
The InChIKey is RTICGMIRUJDABY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO6S3/c1-7-6-9(19-10(7)11(13)14)12-21(17,18)8-2-4-20(15,16)5-3-8/h6,8,12H,2-5H2,1H3,(H,13,14).
What are the key properties of 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid?
5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid has a molecular weight of 353.44 g/mol, XLogP of 1.07, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,1-dioxothian-4-yl)sulfonylamino]-3-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 62084936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).