About N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide
N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide (PubChem CID 62084949) has the molecular formula C8H16ClNO4S2
and a molecular weight of 289.81 g/mol. Its IUPAC name is N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide |
| PubChem CID | 62084949 |
| Molecular Formula | C8H16ClNO4S2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCCCCl)CC1 |
| InChI | InChI=1S/C8H16ClNO4S2/c9-4-1-5-10-16(13,14)8-2-6-15(11,12)7-3-8/h8,10H,1-7H2 |
| InChIKey | POSSTYSEFKWTHW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide?
The IUPAC name of N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide (CID 62084949) is N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide.
What is the SMILES notation for N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide?
The canonical SMILES for N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide is O=S1(=O)CCC(S(=O)(=O)NCCCCl)CC1.
What is the InChIKey of N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide?
The InChIKey is POSSTYSEFKWTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16ClNO4S2/c9-4-1-5-10-16(13,14)8-2-6-15(11,12)7-3-8/h8,10H,1-7H2.
What are the key properties of N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide?
N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide has a molecular weight of 289.81 g/mol, XLogP of 0.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloropropyl)-1,1-dioxothiane-4-sulfonamide is sourced from PubChem (CID 62084949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).