About 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid
5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid (PubChem CID 62085770) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid |
| PubChem CID | 62085770 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid |
| SMILES | Cc1cc(C)cc(Oc2cnc(C(C)C)nc2C(=O)O)c1 |
| InChI | InChI=1S/C16H18N2O3/c1-9(2)15-17-8-13(14(18-15)16(19)20)21-12-6-10(3)5-11(4)7-12/h5-9H,1-4H3,(H,19,20) |
| InChIKey | REILIPTWOWEFGW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid?
The IUPAC name of 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid (CID 62085770) is 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid.
What is the SMILES notation for 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid?
The canonical SMILES for 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid is Cc1cc(C)cc(Oc2cnc(C(C)C)nc2C(=O)O)c1.
What is the InChIKey of 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid?
The InChIKey is REILIPTWOWEFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c1-9(2)15-17-8-13(14(18-15)16(19)20)21-12-6-10(3)5-11(4)7-12/h5-9H,1-4H3,(H,19,20).
What are the key properties of 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid?
5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid has a molecular weight of 286.33 g/mol, XLogP of 3.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethylphenoxy)-2-propan-2-ylpyrimidine-4-carboxylic acid is sourced from PubChem (CID 62085770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).