C13H10Br3NO3 — CID 62085901
6-bromo-N-[(4,5-dibromofuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 62085901) has the molecular formula C13H10Br3NO3 and a molecular weight of 467.94 g/mol. Its IUPAC name is 6-bromo-N-[(4,5-dibromofuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-bromo-N-[(4,5-dibromofuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 62085901 |
| Molecular Formula | C13H10Br3NO3 |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 464.82 |
| IUPAC Name | 6-bromo-N-[(4,5-dibromofuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Brc1cc2c(cc1NCc1cc(Br)c(Br)o1)OCCO2 |
| InChI | InChI=1S/C13H10Br3NO3/c14-8-4-11-12(19-2-1-18-11)5-10(8)17-6-7-3-9(15)13(16)20-7/h3-5,17H,1-2,6H2 |
| InChIKey | OATNCKUWXURUPZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|