C17H24BrNO2 — CID 62085963
(2-bromo-5-methoxyphenyl)-(4-tert-butylpiperidin-1-yl)methanone (PubChem CID 62085963) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is (2-bromo-5-methoxyphenyl)-(4-tert-butylpiperidin-1-yl)methanone.
| Compound Name | (2-bromo-5-methoxyphenyl)-(4-tert-butylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 62085963 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (2-bromo-5-methoxyphenyl)-(4-tert-butylpiperidin-1-yl)methanone |
| SMILES | COc1ccc(Br)c(C(=O)N2CCC(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C17H24BrNO2/c1-17(2,3)12-7-9-19(10-8-12)16(20)14-11-13(21-4)5-6-15(14)18/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | SRGZHFWKGVJWPP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |