About [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol
[1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol (PubChem CID 62086020) has the molecular formula C11H21NO5S2
and a molecular weight of 311.43 g/mol. Its IUPAC name is [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol |
| PubChem CID | 62086020 |
| Molecular Formula | C11H21NO5S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N2CCC(CO)CC2)CC1 |
| InChI | InChI=1S/C11H21NO5S2/c13-9-10-1-5-12(6-2-10)19(16,17)11-3-7-18(14,15)8-4-11/h10-11,13H,1-9H2 |
| InChIKey | PUXZQOHRBPDJRA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol?
The IUPAC name of [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol (CID 62086020) is [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol.
What is the SMILES notation for [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol?
The canonical SMILES for [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol is O=S1(=O)CCC(S(=O)(=O)N2CCC(CO)CC2)CC1.
What is the InChIKey of [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol?
The InChIKey is PUXZQOHRBPDJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO5S2/c13-9-10-1-5-12(6-2-10)19(16,17)11-3-7-18(14,15)8-4-11/h10-11,13H,1-9H2.
What are the key properties of [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol?
[1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol has a molecular weight of 311.43 g/mol, XLogP of -0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,1-dioxothian-4-yl)sulfonylpiperidin-4-yl]methanol is sourced from PubChem (CID 62086020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).