C13H19ClF3N3 — CID 62086377
4-(chloromethyl)-N,2-di(propan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-5-amine (PubChem CID 62086377) has the molecular formula C13H19ClF3N3 and a molecular weight of 309.76 g/mol. Its IUPAC name is 4-(chloromethyl)-N,2-di(propan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-5-amine.
| Compound Name | 4-(chloromethyl)-N,2-di(propan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 62086377 |
| Molecular Formula | C13H19ClF3N3 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 4-(chloromethyl)-N,2-di(propan-2-yl)-N-(2,2,2-trifluoroethyl)pyrimidin-5-amine |
| SMILES | CC(C)c1ncc(N(CC(F)(F)F)C(C)C)c(CCl)n1 |
| InChI | InChI=1S/C13H19ClF3N3/c1-8(2)12-18-6-11(10(5-14)19-12)20(9(3)4)7-13(15,16)17/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | OIDZWZMIBZWPAC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|