C12H26N2O — CID 62088069
1-N-(2-methoxycyclopentyl)-3-methylpentane-1,2-diamine (PubChem CID 62088069) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-N-(2-methoxycyclopentyl)-3-methylpentane-1,2-diamine.
| Compound Name | 1-N-(2-methoxycyclopentyl)-3-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 62088069 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-N-(2-methoxycyclopentyl)-3-methylpentane-1,2-diamine |
| SMILES | CCC(C)C(N)CNC1CCCC1OC |
| InChI | InChI=1S/C12H26N2O/c1-4-9(2)10(13)8-14-11-6-5-7-12(11)15-3/h9-12,14H,4-8,13H2,1-3H3 |
| InChIKey | UNWMSUIUFKTFLK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |