C14H15NO2S — CID 62089370
2-(4-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (PubChem CID 62089370) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol.
| Compound Name | 2-(4-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 62089370 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| SMILES | COc1ccc(-c2nc3c(s2)C(O)CCC3)cc1 |
| InChI | InChI=1S/C14H15NO2S/c1-17-10-7-5-9(6-8-10)14-15-11-3-2-4-12(16)13(11)18-14/h5-8,12,16H,2-4H2,1H3 |
| InChIKey | VQLTXDGOKSOPDG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |