C16H27N5 — CID 62089530
3-(4-tert-butylpiperidin-1-yl)-5,6-dimethylpyridazine-4-carboximidamide (PubChem CID 62089530) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 3-(4-tert-butylpiperidin-1-yl)-5,6-dimethylpyridazine-4-carboximidamide.
| Compound Name | 3-(4-tert-butylpiperidin-1-yl)-5,6-dimethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 62089530 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 3-(4-tert-butylpiperidin-1-yl)-5,6-dimethylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N2CCC(C(C)(C)C)CC2)nnc(C)c1C |
| InChI | InChI=1S/C16H27N5/c1-10-11(2)19-20-15(13(10)14(17)18)21-8-6-12(7-9-21)16(3,4)5/h12H,6-9H2,1-5H3,(H3,17,18) |
| InChIKey | KZDSAPMKJWAION-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|