C15H16N2O2S — CID 62090156
3-[3-(1-thiophen-3-ylethylamino)phenyl]-1,3-oxazolidin-2-one (PubChem CID 62090156) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-[3-(1-thiophen-3-ylethylamino)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[3-(1-thiophen-3-ylethylamino)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 62090156 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-[3-(1-thiophen-3-ylethylamino)phenyl]-1,3-oxazolidin-2-one |
| SMILES | CC(Nc1cccc(N2CCOC2=O)c1)c1ccsc1 |
| InChI | InChI=1S/C15H16N2O2S/c1-11(12-5-8-20-10-12)16-13-3-2-4-14(9-13)17-6-7-19-15(17)18/h2-5,8-11,16H,6-7H2,1H3 |
| InChIKey | TUKCDQOZPIJKEG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |