C11H10ClFN2O — CID 62090270
5-chloro-N-(1-cyanopropan-2-yl)-2-fluorobenzamide (PubChem CID 62090270) has the molecular formula C11H10ClFN2O and a molecular weight of 240.66 g/mol. Its IUPAC name is 5-chloro-N-(1-cyanopropan-2-yl)-2-fluorobenzamide.
| Compound Name | 5-chloro-N-(1-cyanopropan-2-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 62090270 |
| Molecular Formula | C11H10ClFN2O |
| Molecular Weight | 240.66 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 5-chloro-N-(1-cyanopropan-2-yl)-2-fluorobenzamide |
| SMILES | CC(CC#N)NC(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H10ClFN2O/c1-7(4-5-14)15-11(16)9-6-8(12)2-3-10(9)13/h2-3,6-7H,4H2,1H3,(H,15,16) |
| InChIKey | HNMWFIAVCZUCRZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.66 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |