C13H16N4O — CID 62092514
3-(imidazo[1,2-a]pyridin-2-ylmethylamino)piperidin-2-one (PubChem CID 62092514) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethylamino)piperidin-2-one.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethylamino)piperidin-2-one |
|---|---|
| PubChem CID | 62092514 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethylamino)piperidin-2-one |
| SMILES | O=C1NCCCC1NCc1cn2ccccc2n1 |
| InChI | InChI=1S/C13H16N4O/c18-13-11(4-3-6-14-13)15-8-10-9-17-7-2-1-5-12(17)16-10/h1-2,5,7,9,11,15H,3-4,6,8H2,(H,14,18) |
| InChIKey | SYZWDDDCVQMSAX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |