C10H17N3O3 — CID 62092732
N-(2-oxopiperidin-3-yl)morpholine-2-carboxamide (PubChem CID 62092732) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-(2-oxopiperidin-3-yl)morpholine-2-carboxamide.
| Compound Name | N-(2-oxopiperidin-3-yl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 62092732 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-(2-oxopiperidin-3-yl)morpholine-2-carboxamide |
| SMILES | O=C1NCCCC1NC(=O)C1CNCCO1 |
| InChI | InChI=1S/C10H17N3O3/c14-9-7(2-1-3-12-9)13-10(15)8-6-11-4-5-16-8/h7-8,11H,1-6H2,(H,12,14)(H,13,15) |
| InChIKey | YVMVIVPKUOJXKM-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |