C27H20ClN3O7S — CID 6209284
(13E)-16-acetyl-13-[[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]methylidene]-9-methyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one (PubChem CID 6209284) has the molecular formula C27H20ClN3O7S and a molecular weight of 565.99 g/mol. Its IUPAC name is (13E)-16-acetyl-13-[[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]methylidene]-9-methyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one.
| Compound Name | (13E)-16-acetyl-13-[[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]methylidene]-9-methyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one |
|---|---|
| PubChem CID | 6209284 |
| Molecular Formula | C27H20ClN3O7S |
| Molecular Weight | 565.99 g/mol |
| Exact Mass | 565.07 |
| IUPAC Name | (13E)-16-acetyl-13-[[5-[(4-chloro-2-nitrophenoxy)methyl]furan-2-yl]methylidene]-9-methyl-8-oxa-12-thia-10,15-diazatetracyclo[7.6.1.02,7.011,15]hexadeca-2,4,6,10-tetraen-14-one |
| SMILES | CC(=O)C1C2c3ccccc3OC1(C)N=c1s/c(=C/c3ccc(COc4ccc(Cl)cc4[N+](=O)[O-])o3)c(=O)n12 |
| InChI | InChI=1S/C27H20ClN3O7S/c1-14(32)23-24-18-5-3-4-6-20(18)38-27(23,2)29-26-30(24)25(33)22(39-26)12-16-8-9-17(37-16)13-36-21-10-7-15(28)11-19(21)31(34)35/h3-12,23-24H,13H2,1-2H3/b22-12+ |
| InChIKey | PIOCSBHMIJQMNL-WSDLNYQXSA-N |
| XLogP | 4.01 |
| TPSA | 126.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.99 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|