C14H20N2O4 — CID 62093570
3-[(4-hydroxy-3,5-dimethoxyphenyl)methylamino]piperidin-2-one (PubChem CID 62093570) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[(4-hydroxy-3,5-dimethoxyphenyl)methylamino]piperidin-2-one.
| Compound Name | 3-[(4-hydroxy-3,5-dimethoxyphenyl)methylamino]piperidin-2-one |
|---|---|
| PubChem CID | 62093570 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-[(4-hydroxy-3,5-dimethoxyphenyl)methylamino]piperidin-2-one |
| SMILES | COc1cc(CNC2CCCNC2=O)cc(OC)c1O |
| InChI | InChI=1S/C14H20N2O4/c1-19-11-6-9(7-12(20-2)13(11)17)8-16-10-4-3-5-15-14(10)18/h6-7,10,16-17H,3-5,8H2,1-2H3,(H,15,18) |
| InChIKey | ZAKHYABJPAXAAD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |