C11H10N2O5 — CID 62095390
1-[(3-nitrophenyl)carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 62095390) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 1-[(3-nitrophenyl)carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(3-nitrophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 62095390 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-[(3-nitrophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)Nc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C11H10N2O5/c14-9(11(4-5-11)10(15)16)12-7-2-1-3-8(6-7)13(17)18/h1-3,6H,4-5H2,(H,12,14)(H,15,16) |
| InChIKey | LWXRWUCHJBBEQI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|