About 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid
1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 62095401) has the molecular formula C12H11F2NO3
and a molecular weight of 255.22 g/mol. Its IUPAC name is 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid |
| PubChem CID | 62095401 |
| Molecular Formula | C12H11F2NO3 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)Nc2cccc(F)c2F)CCC1 |
| InChI | InChI=1S/C12H11F2NO3/c13-7-3-1-4-8(9(7)14)15-10(16)12(11(17)18)5-2-6-12/h1,3-4H,2,5-6H2,(H,15,16)(H,17,18) |
| InChIKey | AXXAKXZNBJCOCL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid?
The IUPAC name of 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid (CID 62095401) is 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid is O=C(O)C1(C(=O)Nc2cccc(F)c2F)CCC1.
What is the InChIKey of 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid?
The InChIKey is AXXAKXZNBJCOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2NO3/c13-7-3-1-4-8(9(7)14)15-10(16)12(11(17)18)5-2-6-12/h1,3-4H,2,5-6H2,(H,15,16)(H,17,18).
What are the key properties of 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid?
1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid has a molecular weight of 255.22 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,3-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 62095401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).