C17H25NO3 — CID 62095628
butyl 4-hydroxy-4-(1-methyl-2,3-dihydroindol-5-yl)butanoate (PubChem CID 62095628) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is butyl 4-hydroxy-4-(1-methyl-2,3-dihydroindol-5-yl)butanoate.
| Compound Name | butyl 4-hydroxy-4-(1-methyl-2,3-dihydroindol-5-yl)butanoate |
|---|---|
| PubChem CID | 62095628 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | butyl 4-hydroxy-4-(1-methyl-2,3-dihydroindol-5-yl)butanoate |
| SMILES | CCCCOC(=O)CCC(O)c1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C17H25NO3/c1-3-4-11-21-17(20)8-7-16(19)14-5-6-15-13(12-14)9-10-18(15)2/h5-6,12,16,19H,3-4,7-11H2,1-2H3 |
| InChIKey | RINYPQXOVWVPOR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|