About 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid
2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid (PubChem CID 62096016) has the molecular formula C15H15ClN2O3
and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid |
| PubChem CID | 62096016 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid |
| SMILES | Cc1nc(=O)n(-c2ccc(Cl)cc2)c(C)c1C(C)C(=O)O |
| InChI | InChI=1S/C15H15ClN2O3/c1-8(14(19)20)13-9(2)17-15(21)18(10(13)3)12-6-4-11(16)5-7-12/h4-8H,1-3H3,(H,19,20) |
| InChIKey | GBDQTRUSHGPQHM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid?
The IUPAC name of 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid (CID 62096016) is 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid.
What is the SMILES notation for 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid?
The canonical SMILES for 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid is Cc1nc(=O)n(-c2ccc(Cl)cc2)c(C)c1C(C)C(=O)O.
What is the InChIKey of 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid?
The InChIKey is GBDQTRUSHGPQHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2O3/c1-8(14(19)20)13-9(2)17-15(21)18(10(13)3)12-6-4-11(16)5-7-12/h4-8H,1-3H3,(H,19,20).
What are the key properties of 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid?
2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid has a molecular weight of 306.75 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-chlorophenyl)-4,6-dimethyl-2-oxopyrimidin-5-yl]propanoic acid is sourced from PubChem (CID 62096016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).